About 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one
3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 121224655) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 121224655 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC1(C)NC(=S)N(c2ccccc2O)C1=O |
| InChI | InChI=1S/C11H12N2O2S/c1-11(2)9(15)13(10(16)12-11)7-5-3-4-6-8(7)14/h3-6,14H,1-2H3,(H,12,16) |
| InChIKey | XJZSJQMAIMVXTF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (CID 121224655) is 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one is CC1(C)NC(=S)N(c2ccccc2O)C1=O.
What is the InChIKey of 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one?
The InChIKey is XJZSJQMAIMVXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-11(2)9(15)13(10(16)12-11)7-5-3-4-6-8(7)14/h3-6,14H,1-2H3,(H,12,16).
What are the key properties of 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one?
3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one has a molecular weight of 236.30 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyphenyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 121224655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).