About 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid
3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid (PubChem CID 121225033) has the molecular formula C20H19NO4S
and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 121225033 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid |
| SMILES | COc1cccc(-c2cccc(C(CC(=O)O)c3nccs3)c2)c1OC |
| InChI | InChI=1S/C20H19NO4S/c1-24-17-8-4-7-15(19(17)25-2)13-5-3-6-14(11-13)16(12-18(22)23)20-21-9-10-26-20/h3-11,16H,12H2,1-2H3,(H,22,23) |
| InChIKey | YUNVHQSVLSQZCF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid (CID 121225033) is 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid is COc1cccc(-c2cccc(C(CC(=O)O)c3nccs3)c2)c1OC.
What is the InChIKey of 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The InChIKey is YUNVHQSVLSQZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4S/c1-24-17-8-4-7-15(19(17)25-2)13-5-3-6-14(11-13)16(12-18(22)23)20-21-9-10-26-20/h3-11,16H,12H2,1-2H3,(H,22,23).
What are the key properties of 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid has a molecular weight of 369.44 g/mol, XLogP of 4.43, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,3-dimethoxyphenyl)phenyl]-3-(1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 121225033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).