C23H23N7O7S — CID 121225437
[(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazo[2,1-f]purin-3-yloxolan-2-yl]methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate (PubChem CID 121225437) has the molecular formula C23H23N7O7S and a molecular weight of 541.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazo[2,1-f]purin-3-yloxolan-2-yl]methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazo[2,1-f]purin-3-yloxolan-2-yl]methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate |
|---|---|
| PubChem CID | 121225437 |
| Molecular Formula | C23H23N7O7S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-imidazo[2,1-f]purin-3-yloxolan-2-yl]methyl N-[3-(1H-indol-3-yl)propanoyl]sulfamate |
| SMILES | O=C(CCc1c[nH]c2ccccc12)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c2ncn2ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H23N7O7S/c31-17(6-5-13-9-25-15-4-2-1-3-14(13)15)28-38(34,35)36-10-16-19(32)20(33)23(37-16)30-12-26-18-21-24-7-8-29(21)11-27-22(18)30/h1-4,7-9,11-12,16,19-20,23,25,32-33H,5-6,10H2,(H,28,31)/t16-,19-,20-,23-/m1/s1 |
| InChIKey | QPCNFYXTDYZQFI-UGTJMOTHSA-N |
| XLogP | 0.19 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |