C10H12N3O7- — CID 121225533
(2S,3S,4S,5R,6S)-6-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 121225533) has the molecular formula C10H12N3O7- and a molecular weight of 286.22 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | (2S,3S,4S,5R,6S)-6-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 121225533 |
| Molecular Formula | C10H12N3O7- |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | Nc1ccn([C@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C10H13N3O7/c11-3-1-2-13(10(19)12-3)8-6(16)4(14)5(15)7(20-8)9(17)18/h1-2,4-8,14-16H,(H,17,18)(H2,11,12,19)/p-1/t4-,5-,6+,7-,8-/m0/s1 |
| InChIKey | CHKIQPXDGYGCHW-RLMOJYMMSA-M |
| XLogP | -4.44 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |