C15H21N9O — CID 121225598
2-(furan-2-yl)-5-N-[2-(4-methylpiperazin-1-yl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 121225598) has the molecular formula C15H21N9O and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-[2-(4-methylpiperazin-1-yl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-[2-(4-methylpiperazin-1-yl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 121225598 |
| Molecular Formula | C15H21N9O |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-(furan-2-yl)-5-N-[2-(4-methylpiperazin-1-yl)ethyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | CN1CCN(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C15H21N9O/c1-22-6-8-23(9-7-22)5-4-17-14-19-13(16)24-15(20-14)18-12(21-24)11-3-2-10-25-11/h2-3,10H,4-9H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | NLHRMBTYEDTOKC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |