C33H50N2O5Si — CID 121225611
[(2R)-2-[4-(4-phenyldiazenylphenyl)butanoyloxy]-3-triethylsilyloxypropyl] octanoate (PubChem CID 121225611) has the molecular formula C33H50N2O5Si and a molecular weight of 582.86 g/mol. Its IUPAC name is [(2R)-2-[4-(4-phenyldiazenylphenyl)butanoyloxy]-3-triethylsilyloxypropyl] octanoate.
| Compound Name | [(2R)-2-[4-(4-phenyldiazenylphenyl)butanoyloxy]-3-triethylsilyloxypropyl] octanoate |
|---|---|
| PubChem CID | 121225611 |
| Molecular Formula | C33H50N2O5Si |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | [(2R)-2-[4-(4-phenyldiazenylphenyl)butanoyloxy]-3-triethylsilyloxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](CO[Si](CC)(CC)CC)OC(=O)CCCc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C33H50N2O5Si/c1-5-9-10-11-15-20-32(36)38-26-31(27-39-41(6-2,7-3)8-4)40-33(37)21-16-17-28-22-24-30(25-23-28)35-34-29-18-13-12-14-19-29/h12-14,18-19,22-25,31H,5-11,15-17,20-21,26-27H2,1-4H3/b35-34+/t31-/m1/s1 |
| InChIKey | RXXCFTBGWRBCFU-XPUFJXRBSA-N |
| XLogP | 9.26 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|