C25H28N8 — CID 121225852
3,5-bis(1-benzyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 121225852) has the molecular formula C25H28N8 and a molecular weight of 440.56 g/mol. Its IUPAC name is 3,5-bis(1-benzyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 3,5-bis(1-benzyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 121225852 |
| Molecular Formula | C25H28N8 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3,5-bis(1-benzyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | c1ccc(Cn2cc(C3CCC4NNC(c5cn(Cc6ccccc6)nn5)C4C3)nn2)cc1 |
| InChI | InChI=1S/C25H28N8/c1-3-7-18(8-4-1)14-32-16-23(27-30-32)20-11-12-22-21(13-20)25(29-26-22)24-17-33(31-28-24)15-19-9-5-2-6-10-19/h1-10,16-17,20-22,25-26,29H,11-15H2 |
| InChIKey | NOCWGUUVYNOJMX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |