About (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol
(4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol (PubChem CID 121226317) has the molecular formula C13H13ClOS
and a molecular weight of 252.77 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol.
Molecular Properties
| Compound Name | (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol |
| PubChem CID | 121226317 |
| Molecular Formula | C13H13ClOS |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol |
| SMILES | Cc1sc(C(O)c2ccccc2)c(C)c1Cl |
| InChI | InChI=1S/C13H13ClOS/c1-8-11(14)9(2)16-13(8)12(15)10-6-4-3-5-7-10/h3-7,12,15H,1-2H3 |
| InChIKey | GLYRWTSVZVXVOB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol?
The IUPAC name of (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol (CID 121226317) is (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol.
What is the SMILES notation for (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol?
The canonical SMILES for (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol is Cc1sc(C(O)c2ccccc2)c(C)c1Cl.
What is the InChIKey of (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol?
The InChIKey is GLYRWTSVZVXVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClOS/c1-8-11(14)9(2)16-13(8)12(15)10-6-4-3-5-7-10/h3-7,12,15H,1-2H3.
What are the key properties of (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol?
(4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol has a molecular weight of 252.77 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3,5-dimethylthiophen-2-yl)-phenylmethanol is sourced from PubChem (CID 121226317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).