About 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine
3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 121226470) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 121226470 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cnc(N)c2c1ncn2O |
| InChI | InChI=1S/C7H8N4O/c1-4-2-9-7(8)6-5(4)10-3-11(6)12/h2-3,12H,1H3,(H2,8,9) |
| InChIKey | JRUBVJGRIQRLLF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine (CID 121226470) is 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine is Cc1cnc(N)c2c1ncn2O.
What is the InChIKey of 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine?
The InChIKey is JRUBVJGRIQRLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-4-2-9-7(8)6-5(4)10-3-11(6)12/h2-3,12H,1H3,(H2,8,9).
What are the key properties of 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine?
3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine has a molecular weight of 164.17 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-7-methylimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 121226470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).