C21H19F4N3O — CID 1212265
4-[[2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methyl]morpholine (PubChem CID 1212265) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is 4-[[2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methyl]morpholine.
| Compound Name | 4-[[2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 1212265 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[[2,3,5,6-tetrafluoro-4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]methyl]morpholine |
| SMILES | Cc1cc(-c2ccccc2)n(-c2c(F)c(F)c(CN3CCOCC3)c(F)c2F)n1 |
| InChI | InChI=1S/C21H19F4N3O/c1-13-11-16(14-5-3-2-4-6-14)28(26-13)21-19(24)17(22)15(18(23)20(21)25)12-27-7-9-29-10-8-27/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | GDIUCXHWSBJYQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|