About 4-methylsulfanyl-1,3-thiazole-2-carboxamide
4-methylsulfanyl-1,3-thiazole-2-carboxamide (PubChem CID 121226614) has the molecular formula C5H6N2OS2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-methylsulfanyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-methylsulfanyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 121226614 |
| Molecular Formula | C5H6N2OS2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | 4-methylsulfanyl-1,3-thiazole-2-carboxamide |
| SMILES | CSc1csc(C(N)=O)n1 |
| InChI | InChI=1S/C5H6N2OS2/c1-9-3-2-10-5(7-3)4(6)8/h2H,1H3,(H2,6,8) |
| InChIKey | UIXYWITYZTWPQE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylsulfanyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-methylsulfanyl-1,3-thiazole-2-carboxamide (CID 121226614) is 4-methylsulfanyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-methylsulfanyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-methylsulfanyl-1,3-thiazole-2-carboxamide is CSc1csc(C(N)=O)n1.
What is the InChIKey of 4-methylsulfanyl-1,3-thiazole-2-carboxamide?
The InChIKey is UIXYWITYZTWPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS2/c1-9-3-2-10-5(7-3)4(6)8/h2H,1H3,(H2,6,8).
What are the key properties of 4-methylsulfanyl-1,3-thiazole-2-carboxamide?
4-methylsulfanyl-1,3-thiazole-2-carboxamide has a molecular weight of 174.25 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 121226614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).