About 1,3-dimethyl-1-propoxyurea
1,3-dimethyl-1-propoxyurea (PubChem CID 121226994) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1,3-dimethyl-1-propoxyurea.
Molecular Properties
| Compound Name | 1,3-dimethyl-1-propoxyurea |
| PubChem CID | 121226994 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1,3-dimethyl-1-propoxyurea |
| SMILES | CCCON(C)C(=O)NC |
| InChI | InChI=1S/C6H14N2O2/c1-4-5-10-8(3)6(9)7-2/h4-5H2,1-3H3,(H,7,9) |
| InChIKey | PQGXARSNUDRLMP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1-propoxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1-propoxyurea?
The IUPAC name of 1,3-dimethyl-1-propoxyurea (CID 121226994) is 1,3-dimethyl-1-propoxyurea.
What is the SMILES notation for 1,3-dimethyl-1-propoxyurea?
The canonical SMILES for 1,3-dimethyl-1-propoxyurea is CCCON(C)C(=O)NC.
What is the InChIKey of 1,3-dimethyl-1-propoxyurea?
The InChIKey is PQGXARSNUDRLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-4-5-10-8(3)6(9)7-2/h4-5H2,1-3H3,(H,7,9).
What are the key properties of 1,3-dimethyl-1-propoxyurea?
1,3-dimethyl-1-propoxyurea has a molecular weight of 146.19 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1-propoxyurea is sourced from PubChem (CID 121226994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).