C10H12O — CID 121227035
cis-(1R,2S)-2-methyl-2-phenylcyclopropan-1-ol (PubChem CID 121227035) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is cis-(1R,2S)-2-methyl-2-phenylcyclopropan-1-ol.
| Compound Name | cis-(1R,2S)-2-methyl-2-phenylcyclopropan-1-ol |
|---|---|
| PubChem CID | 121227035 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | cis-(1R,2S)-2-methyl-2-phenylcyclopropan-1-ol |
| SMILES | C[C@@]1(c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C10H12O/c1-10(7-9(10)11)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | AIRNKBPAQXJDBS-ZJUUUORDSA-N |
| XLogP | 1.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |