About 1-[(1R,2S)-2-methylcyclopentyl]pyrrole
1-[(1R,2S)-2-methylcyclopentyl]pyrrole (PubChem CID 121227210) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclopentyl]pyrrole.
Molecular Properties
| Compound Name | 1-[(1R,2S)-2-methylcyclopentyl]pyrrole |
| PubChem CID | 121227210 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclopentyl]pyrrole |
| SMILES | C[C@H]1CCC[C@H]1n1cccc1 |
| InChI | InChI=1S/C10H15N/c1-9-5-4-6-10(9)11-7-2-3-8-11/h2-3,7-10H,4-6H2,1H3/t9-,10+/m0/s1 |
| InChIKey | IIFIVULCXNBLQG-VHSXEESVSA-N |
| XLogP | 2.85 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R,2S)-2-methylcyclopentyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-2-methylcyclopentyl]pyrrole?
The IUPAC name of 1-[(1R,2S)-2-methylcyclopentyl]pyrrole (CID 121227210) is 1-[(1R,2S)-2-methylcyclopentyl]pyrrole.
What is the SMILES notation for 1-[(1R,2S)-2-methylcyclopentyl]pyrrole?
The canonical SMILES for 1-[(1R,2S)-2-methylcyclopentyl]pyrrole is C[C@H]1CCC[C@H]1n1cccc1.
What is the InChIKey of 1-[(1R,2S)-2-methylcyclopentyl]pyrrole?
The InChIKey is IIFIVULCXNBLQG-VHSXEESVSA-N. The full InChI is InChI=1S/C10H15N/c1-9-5-4-6-10(9)11-7-2-3-8-11/h2-3,7-10H,4-6H2,1H3/t9-,10+/m0/s1.
What are the key properties of 1-[(1R,2S)-2-methylcyclopentyl]pyrrole?
1-[(1R,2S)-2-methylcyclopentyl]pyrrole has a molecular weight of 149.24 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-2-methylcyclopentyl]pyrrole is sourced from PubChem (CID 121227210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).