About N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide
N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide (PubChem CID 121227549) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide |
| PubChem CID | 121227549 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide |
| SMILES | CC(=O)NC1C(=O)NN=C1N |
| InChI | InChI=1S/C5H8N4O2/c1-2(10)7-3-4(6)8-9-5(3)11/h3H,1H3,(H2,6,8)(H,7,10)(H,9,11) |
| InChIKey | PSBRKWPUGYFRTF-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide?
The IUPAC name of N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide (CID 121227549) is N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide.
What is the SMILES notation for N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide?
The canonical SMILES for N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide is CC(=O)NC1C(=O)NN=C1N.
What is the InChIKey of N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide?
The InChIKey is PSBRKWPUGYFRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c1-2(10)7-3-4(6)8-9-5(3)11/h3H,1H3,(H2,6,8)(H,7,10)(H,9,11).
What are the key properties of N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide?
N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide has a molecular weight of 156.15 g/mol, XLogP of -2.11, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-5-oxo-1,4-dihydropyrazol-4-yl)acetamide is sourced from PubChem (CID 121227549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).