C10H9F2NO4 — CID 121228590
ethyl 2-(2,3-difluoro-5-nitrophenyl)acetate (PubChem CID 121228590) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is ethyl 2-(2,3-difluoro-5-nitrophenyl)acetate.
| Compound Name | ethyl 2-(2,3-difluoro-5-nitrophenyl)acetate |
|---|---|
| PubChem CID | 121228590 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | ethyl 2-(2,3-difluoro-5-nitrophenyl)acetate |
| SMILES | CCOC(=O)Cc1cc([N+](=O)[O-])cc(F)c1F |
| InChI | InChI=1S/C10H9F2NO4/c1-2-17-9(14)4-6-3-7(13(15)16)5-8(11)10(6)12/h3,5H,2,4H2,1H3 |
| InChIKey | GAGINPFJUOKVID-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|