C11H17N3O — CID 121229517
7-(imidazol-1-ylmethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine (PubChem CID 121229517) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 7-(imidazol-1-ylmethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine.
| Compound Name | 7-(imidazol-1-ylmethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 121229517 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 7-(imidazol-1-ylmethyl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
| SMILES | c1cn(CC2CCC3NCCOC23)cn1 |
| InChI | InChI=1S/C11H17N3O/c1-2-10-11(15-6-4-13-10)9(1)7-14-5-3-12-8-14/h3,5,8-11,13H,1-2,4,6-7H2 |
| InChIKey | AIMYDOCETLBOBD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |