C14H24INO3 — CID 121229816
tert-butyl 7-(iodomethyl)-6-oxa-2-azaspiro[4.5]decane-2-carboxylate (PubChem CID 121229816) has the molecular formula C14H24INO3 and a molecular weight of 381.25 g/mol. Its IUPAC name is tert-butyl 7-(iodomethyl)-6-oxa-2-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 7-(iodomethyl)-6-oxa-2-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 121229816 |
| Molecular Formula | C14H24INO3 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | tert-butyl 7-(iodomethyl)-6-oxa-2-azaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCC(CI)O2)C1 |
| InChI | InChI=1S/C14H24INO3/c1-13(2,3)19-12(17)16-8-7-14(10-16)6-4-5-11(9-15)18-14/h11H,4-10H2,1-3H3 |
| InChIKey | XEGXXMPNXYWNKF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|