C8H11F3N2O3 — CID 121229938
ethyl 6-oxo-4-(trifluoromethyl)diazinane-3-carboxylate (PubChem CID 121229938) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is ethyl 6-oxo-4-(trifluoromethyl)diazinane-3-carboxylate.
| Compound Name | ethyl 6-oxo-4-(trifluoromethyl)diazinane-3-carboxylate |
|---|---|
| PubChem CID | 121229938 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 6-oxo-4-(trifluoromethyl)diazinane-3-carboxylate |
| SMILES | CCOC(=O)C1NNC(=O)CC1C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O3/c1-2-16-7(15)6-4(8(9,10)11)3-5(14)12-13-6/h4,6,13H,2-3H2,1H3,(H,12,14) |
| InChIKey | QAGZNUZTXXEZBF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |