C19H19NO4 — CID 121230012
5-methoxy-2-[2-(pyrrolidine-3-carbonyl)phenyl]benzoic acid (PubChem CID 121230012) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 5-methoxy-2-[2-(pyrrolidine-3-carbonyl)phenyl]benzoic acid.
| Compound Name | 5-methoxy-2-[2-(pyrrolidine-3-carbonyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 121230012 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 5-methoxy-2-[2-(pyrrolidine-3-carbonyl)phenyl]benzoic acid |
| SMILES | COc1ccc(-c2ccccc2C(=O)C2CCNC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H19NO4/c1-24-13-6-7-15(17(10-13)19(22)23)14-4-2-3-5-16(14)18(21)12-8-9-20-11-12/h2-7,10,12,20H,8-9,11H2,1H3,(H,22,23) |
| InChIKey | AYZRYSCZBYVOQH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |