C12H23N3O — CID 121230409
(2S)-2-amino-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one (PubChem CID 121230409) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-amino-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 121230409 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (2S)-2-amino-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one |
| SMILES | C[C@H](N)C(=O)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C12H23N3O/c1-9(13)12(16)15-6-4-11(5-7-15)14-8-10-2-3-10/h9-11,14H,2-8,13H2,1H3/t9-/m0/s1 |
| InChIKey | BUFWUJYCDMQNBG-VIFPVBQESA-N |
| XLogP | 0.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |