About (4,4-difluorocyclohexyl)hydrazine;dihydrochloride
(4,4-difluorocyclohexyl)hydrazine;dihydrochloride (PubChem CID 121231079) has the molecular formula C6H14Cl2F2N2
and a molecular weight of 223.09 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)hydrazine;dihydrochloride.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)hydrazine;dihydrochloride |
| PubChem CID | 121231079 |
| Molecular Formula | C6H14Cl2F2N2 |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (4,4-difluorocyclohexyl)hydrazine;dihydrochloride |
| SMILES | Cl.Cl.NNC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C6H12F2N2.2ClH/c7-6(8)3-1-5(10-9)2-4-6;;/h5,10H,1-4,9H2;2*1H |
| InChIKey | KPMPAFZALVDGTA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluorocyclohexyl)hydrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)hydrazine;dihydrochloride?
The IUPAC name of (4,4-difluorocyclohexyl)hydrazine;dihydrochloride (CID 121231079) is (4,4-difluorocyclohexyl)hydrazine;dihydrochloride.
What is the SMILES notation for (4,4-difluorocyclohexyl)hydrazine;dihydrochloride?
The canonical SMILES for (4,4-difluorocyclohexyl)hydrazine;dihydrochloride is Cl.Cl.NNC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)hydrazine;dihydrochloride?
The InChIKey is KPMPAFZALVDGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2.2ClH/c7-6(8)3-1-5(10-9)2-4-6;;/h5,10H,1-4,9H2;2*1H.
What are the key properties of (4,4-difluorocyclohexyl)hydrazine;dihydrochloride?
(4,4-difluorocyclohexyl)hydrazine;dihydrochloride has a molecular weight of 223.09 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)hydrazine;dihydrochloride is sourced from PubChem (CID 121231079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).