About sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate
sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate (PubChem CID 121231436) has the molecular formula C4H11N3NaO6P
and a molecular weight of 251.11 g/mol. Its IUPAC name is sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate.
Molecular Properties
| Compound Name | sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate |
| PubChem CID | 121231436 |
| Molecular Formula | C4H11N3NaO6P |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate |
| SMILES | CN(CC(=O)[O-])C(N)=NP(=O)(O)O.O.[Na+] |
| InChI | InChI=1S/C4H10N3O5P.Na.H2O/c1-7(2-3(8)9)4(5)6-13(10,11)12;;/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;1H2/q;+1;/p-1 |
| InChIKey | DUXMAYWIASUPMV-UHFFFAOYSA-M |
| XLogP | -6.75 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate?
The IUPAC name of sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate (CID 121231436) is sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate.
What is the SMILES notation for sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate?
The canonical SMILES for sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate is CN(CC(=O)[O-])C(N)=NP(=O)(O)O.O.[Na+].
What is the InChIKey of sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate?
The InChIKey is DUXMAYWIASUPMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10N3O5P.Na.H2O/c1-7(2-3(8)9)4(5)6-13(10,11)12;;/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;1H2/q;+1;/p-1.
What are the key properties of sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate?
sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate has a molecular weight of 251.11 g/mol, XLogP of -6.75, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetate;hydrate is sourced from PubChem (CID 121231436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).