C17H20N4O3 — CID 121231453
ethyl 2-[[3-(3-amino-4-pyridinyl)phenyl]methylcarbamoylamino]acetate (PubChem CID 121231453) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 2-[[3-(3-amino-4-pyridinyl)phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-(3-amino-4-pyridinyl)phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 121231453 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 2-[[3-(3-amino-4-pyridinyl)phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2ccncc2N)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-2-24-16(22)11-21-17(23)20-9-12-4-3-5-13(8-12)14-6-7-19-10-15(14)18/h3-8,10H,2,9,11,18H2,1H3,(H2,20,21,23) |
| InChIKey | BMVIHQIQLWPWDF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |