About 2-(difluoromethyl)-3,6-dimethylpyridine
2-(difluoromethyl)-3,6-dimethylpyridine (PubChem CID 121232017) has the molecular formula C8H9F2N
and a molecular weight of 157.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-3,6-dimethylpyridine |
| PubChem CID | 121232017 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-(difluoromethyl)-3,6-dimethylpyridine |
| SMILES | Cc1ccc(C)c(C(F)F)n1 |
| InChI | InChI=1S/C8H9F2N/c1-5-3-4-6(2)11-7(5)8(9)10/h3-4,8H,1-2H3 |
| InChIKey | TXYSITBELPOFLC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethyl)-3,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-3,6-dimethylpyridine?
The IUPAC name of 2-(difluoromethyl)-3,6-dimethylpyridine (CID 121232017) is 2-(difluoromethyl)-3,6-dimethylpyridine.
What is the SMILES notation for 2-(difluoromethyl)-3,6-dimethylpyridine?
The canonical SMILES for 2-(difluoromethyl)-3,6-dimethylpyridine is Cc1ccc(C)c(C(F)F)n1.
What is the InChIKey of 2-(difluoromethyl)-3,6-dimethylpyridine?
The InChIKey is TXYSITBELPOFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N/c1-5-3-4-6(2)11-7(5)8(9)10/h3-4,8H,1-2H3.
What are the key properties of 2-(difluoromethyl)-3,6-dimethylpyridine?
2-(difluoromethyl)-3,6-dimethylpyridine has a molecular weight of 157.16 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-3,6-dimethylpyridine is sourced from PubChem (CID 121232017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).