C6H4BrF3N2O2S — CID 121232220
5-bromo-2-methylsulfonyl-4-(trifluoromethyl)pyrimidine (PubChem CID 121232220) has the molecular formula C6H4BrF3N2O2S and a molecular weight of 305.08 g/mol. Its IUPAC name is 5-bromo-2-methylsulfonyl-4-(trifluoromethyl)pyrimidine.
| Compound Name | 5-bromo-2-methylsulfonyl-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 121232220 |
| Molecular Formula | C6H4BrF3N2O2S |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 5-bromo-2-methylsulfonyl-4-(trifluoromethyl)pyrimidine |
| SMILES | CS(=O)(=O)c1ncc(Br)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H4BrF3N2O2S/c1-15(13,14)5-11-2-3(7)4(12-5)6(8,9)10/h2H,1H3 |
| InChIKey | KPYZFRSKRAWDNI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |