C7HCl4N3 — CID 121232247
2,3,5,7-tetrachloropyrido[3,4-b]pyrazine (PubChem CID 121232247) has the molecular formula C7HCl4N3 and a molecular weight of 268.92 g/mol. Its IUPAC name is 2,3,5,7-tetrachloropyrido[3,4-b]pyrazine.
| Compound Name | 2,3,5,7-tetrachloropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 121232247 |
| Molecular Formula | C7HCl4N3 |
| Molecular Weight | 268.92 g/mol |
| Exact Mass | 266.89 |
| IUPAC Name | 2,3,5,7-tetrachloropyrido[3,4-b]pyrazine |
| SMILES | Clc1cc2nc(Cl)c(Cl)nc2c(Cl)n1 |
| InChI | InChI=1S/C7HCl4N3/c8-3-1-2-4(5(9)13-3)14-7(11)6(10)12-2/h1H |
| InChIKey | NRXVZHVLVVJFFC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|