C22H32O3S — CID 121232377
(4Z,7Z,10Z,13Z,15S,19Z)-17-oxo-15-sulfanyldocosa-4,7,10,13,19-pentaenoic acid (PubChem CID 121232377) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,15S,19Z)-17-oxo-15-sulfanyldocosa-4,7,10,13,19-pentaenoic acid.
| Compound Name | (4Z,7Z,10Z,13Z,15S,19Z)-17-oxo-15-sulfanyldocosa-4,7,10,13,19-pentaenoic acid |
|---|---|
| PubChem CID | 121232377 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (4Z,7Z,10Z,13Z,15S,19Z)-17-oxo-15-sulfanyldocosa-4,7,10,13,19-pentaenoic acid |
| SMILES | CC/C=C\CC(=O)C[C@H](S)/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O3S/c1-2-3-13-16-20(23)19-21(26)17-14-11-9-7-5-4-6-8-10-12-15-18-22(24)25/h3-4,6-7,9-10,12-14,17,21,26H,2,5,8,11,15-16,18-19H2,1H3,(H,24,25)/b6-4-,9-7-,12-10-,13-3-,17-14-/t21-/m1/s1 |
| InChIKey | HKAGOJZTRHLYDH-VADHRGGMSA-N |
| XLogP | 5.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|