C20H22N4O — CID 121232387
2-[6-(1-hydroxycyclohexyl)-2-pyridinyl]-1H-indole-5-carboximidamide (PubChem CID 121232387) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[6-(1-hydroxycyclohexyl)-2-pyridinyl]-1H-indole-5-carboximidamide.
| Compound Name | 2-[6-(1-hydroxycyclohexyl)-2-pyridinyl]-1H-indole-5-carboximidamide |
|---|---|
| PubChem CID | 121232387 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[6-(1-hydroxycyclohexyl)-2-pyridinyl]-1H-indole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(-c3cccc(C4(O)CCCCC4)n3)cc2c1 |
| InChI | InChI=1S/C20H22N4O/c21-19(22)13-7-8-15-14(11-13)12-17(23-15)16-5-4-6-18(24-16)20(25)9-2-1-3-10-20/h4-8,11-12,23,25H,1-3,9-10H2,(H3,21,22) |
| InChIKey | VXVYXKAPTSJLCT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|