C6H15N7O — CID 121232523
1-aminopropan-2-ol;1,3,5-triazine-2,4,6-triamine (PubChem CID 121232523) has the molecular formula C6H15N7O and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-aminopropan-2-ol;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1-aminopropan-2-ol;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 121232523 |
| Molecular Formula | C6H15N7O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-aminopropan-2-ol;1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(O)CN.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C3H6N6.C3H9NO/c4-1-7-2(5)9-3(6)8-1;1-3(5)2-4/h(H6,4,5,6,7,8,9);3,5H,2,4H2,1H3 |
| InChIKey | KVOKPLHQNFFUOE-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |