C15H26O — CID 121232663
3-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 121232663) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 121232663 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | CC(C)=CCC/C(C)=C/CCC1OC1(C)C |
| InChI | InChI=1S/C15H26O/c1-12(2)8-6-9-13(3)10-7-11-14-15(4,5)16-14/h8,10,14H,6-7,9,11H2,1-5H3/b13-10+ |
| InChIKey | GDZKVFAAHPZNAI-JLHYYAGUSA-N |
| XLogP | 4.64 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|