C11H18O2 — CID 121232664
(5Z,8Z)-undeca-1,5,8-triene-3,7-diol (PubChem CID 121232664) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (5Z,8Z)-undeca-1,5,8-triene-3,7-diol.
| Compound Name | (5Z,8Z)-undeca-1,5,8-triene-3,7-diol |
|---|---|
| PubChem CID | 121232664 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (5Z,8Z)-undeca-1,5,8-triene-3,7-diol |
| SMILES | C=CC(O)C/C=C\C(O)/C=C\CC |
| InChI | InChI=1S/C11H18O2/c1-3-5-7-11(13)9-6-8-10(12)4-2/h4-7,9-13H,2-3,8H2,1H3/b7-5-,9-6- |
| InChIKey | FYXKYWVJJJIYHK-BSIYMUDXSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|