C11H16O2 — CID 121232665
(8E)-undeca-1,8-dien-5-yne-3,7-diol (PubChem CID 121232665) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (8E)-undeca-1,8-dien-5-yne-3,7-diol.
| Compound Name | (8E)-undeca-1,8-dien-5-yne-3,7-diol |
|---|---|
| PubChem CID | 121232665 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (8E)-undeca-1,8-dien-5-yne-3,7-diol |
| SMILES | C=CC(O)CC#CC(O)/C=C/CC |
| InChI | InChI=1S/C11H16O2/c1-3-5-7-11(13)9-6-8-10(12)4-2/h4-5,7,10-13H,2-3,8H2,1H3/b7-5+ |
| InChIKey | PGQGHRFGAAUNBD-FNORWQNLSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|