C20H14NO6- — CID 121232726
2-carbamoyl-3,10,11,12-tetrahydroxy-6-methyltetracen-1-olate (PubChem CID 121232726) has the molecular formula C20H14NO6- and a molecular weight of 364.33 g/mol. Its IUPAC name is 2-carbamoyl-3,10,11,12-tetrahydroxy-6-methyltetracen-1-olate.
| Compound Name | 2-carbamoyl-3,10,11,12-tetrahydroxy-6-methyltetracen-1-olate |
|---|---|
| PubChem CID | 121232726 |
| Molecular Formula | C20H14NO6- |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-carbamoyl-3,10,11,12-tetrahydroxy-6-methyltetracen-1-olate |
| SMILES | Cc1c2cccc(O)c2c(O)c2c(O)c3c([O-])c(C(N)=O)c(O)cc3cc12 |
| InChI | InChI=1S/C20H15NO6/c1-7-9-3-2-4-11(22)14(9)19(26)15-10(7)5-8-6-12(23)16(20(21)27)18(25)13(8)17(15)24/h2-6,22-26H,1H3,(H2,21,27)/p-1 |
| InChIKey | WBDQDVXPSGTJAV-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|