C10H8N2 — CID 121232920
(1Z,4Z,6Z)-2,3-benzodiazocine (PubChem CID 121232920) has the molecular formula C10H8N2 and a molecular weight of 156.19 g/mol. Its IUPAC name is (1Z,4Z,6Z)-2,3-benzodiazocine.
| Compound Name | (1Z,4Z,6Z)-2,3-benzodiazocine |
|---|---|
| PubChem CID | 121232920 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (1Z,4Z,6Z)-2,3-benzodiazocine |
| SMILES | C1=C\N=N/C=c2/cccc/c2=C/1 |
| InChI | InChI=1S/C10H8N2/c1-2-5-10-8-12-11-7-3-6-9(10)4-1/h1-8H/b6-3-,7-3-,9-6-,10-8-,11-7-,12-8-,12-11- |
| InChIKey | VRZOZJRPYJYBAA-JPWXTKTPSA-N |
| XLogP | 1.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |