C9H8N2 — CID 121232937
(3aZ,5Z,9E)-1H-pyrrolo[2,3-d]azocine (PubChem CID 121232937) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is (3aZ,5Z,9E)-1H-pyrrolo[2,3-d]azocine.
| Compound Name | (3aZ,5Z,9E)-1H-pyrrolo[2,3-d]azocine |
|---|---|
| PubChem CID | 121232937 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (3aZ,5Z,9E)-1H-pyrrolo[2,3-d]azocine |
| SMILES | C1=C\N=C/C=c2/[nH]cc/c2=C/1 |
| InChI | InChI=1S/C9H8N2/c1-2-8-3-7-11-9(8)4-6-10-5-1/h1-7,11H/b2-1-,5-1-,6-4-,8-2-,9-4+,10-5-,10-6- |
| InChIKey | LHVDBYUBKHUSBF-CTHPUWGHSA-N |
| XLogP | 0.17 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |