C13H21Cl7 — CID 121232962
2,3,4,6,7,8,11-heptachlorotridecane (PubChem CID 121232962) has the molecular formula C13H21Cl7 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2,3,4,6,7,8,11-heptachlorotridecane.
| Compound Name | 2,3,4,6,7,8,11-heptachlorotridecane |
|---|---|
| PubChem CID | 121232962 |
| Molecular Formula | C13H21Cl7 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 2,3,4,6,7,8,11-heptachlorotridecane |
| SMILES | CCC(Cl)CCC(Cl)C(Cl)C(Cl)CC(Cl)C(Cl)C(C)Cl |
| InChI | InChI=1S/C13H21Cl7/c1-3-8(15)4-5-9(16)13(20)11(18)6-10(17)12(19)7(2)14/h7-13H,3-6H2,1-2H3 |
| InChIKey | HVAZUEGTYITCDZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|