C8H10ClF10NO2 — CID 121233919
2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine;hydrochloride (PubChem CID 121233919) has the molecular formula C8H10ClF10NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine;hydrochloride.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 121233919 |
| Molecular Formula | C8H10ClF10NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine;hydrochloride |
| SMILES | Cl.FC(F)(F)C(F)(F)OCCNCCOC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F10NO2.ClH/c9-5(10,11)7(15,16)20-3-1-19-2-4-21-8(17,18)6(12,13)14;/h19H,1-4H2;1H |
| InChIKey | QJFVSNRPXPKZJK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|