About hexyl(trimethyl)azanium hexafluorophosphate
hexyl(trimethyl)azanium hexafluorophosphate (PubChem CID 121234264) has the molecular formula C9H22F6NP
and a molecular weight of 289.24 g/mol. Its IUPAC name is hexyl(trimethyl)azanium hexafluorophosphate.
Molecular Properties
| Compound Name | hexyl(trimethyl)azanium hexafluorophosphate |
| PubChem CID | 121234264 |
| Molecular Formula | C9H22F6NP |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | hexyl(trimethyl)azanium hexafluorophosphate |
| SMILES | CCCCCC[N+](C)(C)C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H22N.F6P/c1-5-6-7-8-9-10(2,3)4;1-7(2,3,4,5)6/h5-9H2,1-4H3;/q+1;-1 |
| InChIKey | BNAVQMALJFRYMU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexyl(trimethyl)azanium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl(trimethyl)azanium hexafluorophosphate?
The IUPAC name of hexyl(trimethyl)azanium hexafluorophosphate (CID 121234264) is hexyl(trimethyl)azanium hexafluorophosphate.
What is the SMILES notation for hexyl(trimethyl)azanium hexafluorophosphate?
The canonical SMILES for hexyl(trimethyl)azanium hexafluorophosphate is CCCCCC[N+](C)(C)C.F[P-](F)(F)(F)(F)F.
What is the InChIKey of hexyl(trimethyl)azanium hexafluorophosphate?
The InChIKey is BNAVQMALJFRYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N.F6P/c1-5-6-7-8-9-10(2,3)4;1-7(2,3,4,5)6/h5-9H2,1-4H3;/q+1;-1.
What are the key properties of hexyl(trimethyl)azanium hexafluorophosphate?
hexyl(trimethyl)azanium hexafluorophosphate has a molecular weight of 289.24 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl(trimethyl)azanium hexafluorophosphate is sourced from PubChem (CID 121234264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).