C8H5F9IN — CID 121234380
5,5,6,6,7,7,8,8,8-nonafluoro-3-iodooctanenitrile (PubChem CID 121234380) has the molecular formula C8H5F9IN and a molecular weight of 413.02 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodooctanenitrile.
| Compound Name | 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodooctanenitrile |
|---|---|
| PubChem CID | 121234380 |
| Molecular Formula | C8H5F9IN |
| Molecular Weight | 413.02 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodooctanenitrile |
| SMILES | N#CCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9IN/c9-5(10,3-4(18)1-2-19)6(11,12)7(13,14)8(15,16)17/h4H,1,3H2 |
| InChIKey | AKXMVRXPTWBYIV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|