C12H4F12O2 — CID 121234443
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzodioxole (PubChem CID 121234443) has the molecular formula C12H4F12O2 and a molecular weight of 408.14 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzodioxole.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 121234443 |
| Molecular Formula | C12H4F12O2 |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzodioxole |
| SMILES | FC(F)(F)C(F)(F)C1(C(F)(C(F)(F)F)C(F)(F)F)Oc2ccccc2O1 |
| InChI | InChI=1S/C12H4F12O2/c13-7(10(16,17)18,11(19,20)21)9(8(14,15)12(22,23)24)25-5-3-1-2-4-6(5)26-9/h1-4H |
| InChIKey | QOMGNRHSKADQON-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|