C10H9BrF4O — CID 121234611
4-(2-bromo-1,1,2,2-tetrafluoroethyl)-2,6-dimethylphenol (PubChem CID 121234611) has the molecular formula C10H9BrF4O and a molecular weight of 301.08 g/mol. Its IUPAC name is 4-(2-bromo-1,1,2,2-tetrafluoroethyl)-2,6-dimethylphenol.
| Compound Name | 4-(2-bromo-1,1,2,2-tetrafluoroethyl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 121234611 |
| Molecular Formula | C10H9BrF4O |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4-(2-bromo-1,1,2,2-tetrafluoroethyl)-2,6-dimethylphenol |
| SMILES | Cc1cc(C(F)(F)C(F)(F)Br)cc(C)c1O |
| InChI | InChI=1S/C10H9BrF4O/c1-5-3-7(4-6(2)8(5)16)9(12,13)10(11,14)15/h3-4,16H,1-2H3 |
| InChIKey | MCEPGWSDUPDVPZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|