C18H12F4N2O6 — CID 121234928
1-methyl-2-nitro-3-[3,3,4,4-tetrafluoro-2-(3-methyl-2-nitrophenoxy)cyclobuten-1-yl]oxybenzene (PubChem CID 121234928) has the molecular formula C18H12F4N2O6 and a molecular weight of 428.29 g/mol. Its IUPAC name is 1-methyl-2-nitro-3-[3,3,4,4-tetrafluoro-2-(3-methyl-2-nitrophenoxy)cyclobuten-1-yl]oxybenzene.
| Compound Name | 1-methyl-2-nitro-3-[3,3,4,4-tetrafluoro-2-(3-methyl-2-nitrophenoxy)cyclobuten-1-yl]oxybenzene |
|---|---|
| PubChem CID | 121234928 |
| Molecular Formula | C18H12F4N2O6 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-methyl-2-nitro-3-[3,3,4,4-tetrafluoro-2-(3-methyl-2-nitrophenoxy)cyclobuten-1-yl]oxybenzene |
| SMILES | Cc1cccc(OC2=C(Oc3cccc(C)c3[N+](=O)[O-])C(F)(F)C2(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12F4N2O6/c1-9-5-3-7-11(13(9)23(25)26)29-15-16(18(21,22)17(15,19)20)30-12-8-4-6-10(2)14(12)24(27)28/h3-8H,1-2H3 |
| InChIKey | AGDAZZMWWUVDRQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|