About N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine
N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine (PubChem CID 121235804) has the molecular formula C10H17NSi
and a molecular weight of 179.34 g/mol. Its IUPAC name is N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine |
| PubChem CID | 121235804 |
| Molecular Formula | C10H17NSi |
| Molecular Weight | 179.34 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine |
| SMILES | C=CCN[Si](C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C10H17NSi/c1-4-9-11-12(2,3)10-7-5-6-8-10/h4-8,10-11H,1,9H2,2-3H3 |
| InChIKey | HDLAEDLUXSWNIR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine?
The IUPAC name of N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine (CID 121235804) is N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine.
What is the SMILES notation for N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine?
The canonical SMILES for N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine is C=CCN[Si](C)(C)C1C=CC=C1.
What is the InChIKey of N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine?
The InChIKey is HDLAEDLUXSWNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NSi/c1-4-9-11-12(2,3)10-7-5-6-8-10/h4-8,10-11H,1,9H2,2-3H3.
What are the key properties of N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine?
N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine has a molecular weight of 179.34 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopenta-2,4-dien-1-yl(dimethyl)silyl]prop-2-en-1-amine is sourced from PubChem (CID 121235804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).