C24H42F12O6Si2 — CID 121235932
(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-triethoxysilyldodecyl)-triethoxysilane (PubChem CID 121235932) has the molecular formula C24H42F12O6Si2 and a molecular weight of 710.74 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-triethoxysilyldodecyl)-triethoxysilane.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-triethoxysilyldodecyl)-triethoxysilane |
|---|---|
| PubChem CID | 121235932 |
| Molecular Formula | C24H42F12O6Si2 |
| Molecular Weight | 710.74 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-triethoxysilyldodecyl)-triethoxysilane |
| SMILES | CCO[Si](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C24H42F12O6Si2/c1-7-37-43(38-8-2,39-9-3)17-13-15-19(25,26)21(29,30)23(33,34)24(35,36)22(31,32)20(27,28)16-14-18-44(40-10-4,41-11-5)42-12-6/h7-18H2,1-6H3 |
| InChIKey | YNANGIAQHBAVEA-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.74 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|