C11H6Br2F3N — CID 121236040
3,4-dibromo-2-methyl-8-(trifluoromethyl)quinoline (PubChem CID 121236040) has the molecular formula C11H6Br2F3N and a molecular weight of 368.98 g/mol. Its IUPAC name is 3,4-dibromo-2-methyl-8-(trifluoromethyl)quinoline.
| Compound Name | 3,4-dibromo-2-methyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 121236040 |
| Molecular Formula | C11H6Br2F3N |
| Molecular Weight | 368.98 g/mol |
| Exact Mass | 366.88 |
| IUPAC Name | 3,4-dibromo-2-methyl-8-(trifluoromethyl)quinoline |
| SMILES | Cc1nc2c(C(F)(F)F)cccc2c(Br)c1Br |
| InChI | InChI=1S/C11H6Br2F3N/c1-5-8(12)9(13)6-3-2-4-7(10(6)17-5)11(14,15)16/h2-4H,1H3 |
| InChIKey | UHTIHPXHBXKIDR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.98 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |