C15H15ClF3N3O — CID 121236413
3-chloro-2-methyl-4-piperazin-1-yl-7-(trifluoromethoxy)quinoline (PubChem CID 121236413) has the molecular formula C15H15ClF3N3O and a molecular weight of 345.75 g/mol. Its IUPAC name is 3-chloro-2-methyl-4-piperazin-1-yl-7-(trifluoromethoxy)quinoline.
| Compound Name | 3-chloro-2-methyl-4-piperazin-1-yl-7-(trifluoromethoxy)quinoline |
|---|---|
| PubChem CID | 121236413 |
| Molecular Formula | C15H15ClF3N3O |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-chloro-2-methyl-4-piperazin-1-yl-7-(trifluoromethoxy)quinoline |
| SMILES | Cc1nc2cc(OC(F)(F)F)ccc2c(N2CCNCC2)c1Cl |
| InChI | InChI=1S/C15H15ClF3N3O/c1-9-13(16)14(22-6-4-20-5-7-22)11-3-2-10(8-12(11)21-9)23-15(17,18)19/h2-3,8,20H,4-7H2,1H3 |
| InChIKey | OGZTUXGILWAXSL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |