About (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride
(5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride (PubChem CID 121237517) has the molecular formula C9H10ClN3S
and a molecular weight of 227.72 g/mol. Its IUPAC name is (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride |
| PubChem CID | 121237517 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H9N3S.ClH/c10-12-9-11-6-8(13-9)7-4-2-1-3-5-7;/h1-6H,10H2,(H,11,12);1H |
| InChIKey | GNMZEIXRXGPBGN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride?
The IUPAC name of (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride (CID 121237517) is (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride.
What is the SMILES notation for (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride?
The canonical SMILES for (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride is Cl.NNc1ncc(-c2ccccc2)s1.
What is the InChIKey of (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride?
The InChIKey is GNMZEIXRXGPBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S.ClH/c10-12-9-11-6-8(13-9)7-4-2-1-3-5-7;/h1-6H,10H2,(H,11,12);1H.
What are the key properties of (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride?
(5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride has a molecular weight of 227.72 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,3-thiazol-2-yl)hydrazine;hydrochloride is sourced from PubChem (CID 121237517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).