C10H12ClF3N4 — CID 121237637
N'-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N,N-dimethylmethanimidamide (PubChem CID 121237637) has the molecular formula C10H12ClF3N4 and a molecular weight of 280.68 g/mol. Its IUPAC name is N'-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 121237637 |
| Molecular Formula | C10H12ClF3N4 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N'-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/N(C)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C10H12ClF3N4/c1-17(2)6-15-18(3)9-5-7(10(12,13)14)4-8(11)16-9/h4-6H,1-3H3/b15-6+ |
| InChIKey | ONFVZRQQJOLJBF-GIDUJCDVSA-N |
| XLogP | 2.69 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|