C12H16N4O2 — CID 121237858
8-[(S)-hydroxy(phenyl)methyl]-1,2,3,4,5,7,8,9-octahydropurin-6-one (PubChem CID 121237858) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 8-[(S)-hydroxy(phenyl)methyl]-1,2,3,4,5,7,8,9-octahydropurin-6-one.
| Compound Name | 8-[(S)-hydroxy(phenyl)methyl]-1,2,3,4,5,7,8,9-octahydropurin-6-one |
|---|---|
| PubChem CID | 121237858 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 8-[(S)-hydroxy(phenyl)methyl]-1,2,3,4,5,7,8,9-octahydropurin-6-one |
| SMILES | O=C1NCNC2NC([C@@H](O)c3ccccc3)NC12 |
| InChI | InChI=1S/C12H16N4O2/c17-9(7-4-2-1-3-5-7)11-15-8-10(16-11)13-6-14-12(8)18/h1-5,8-11,13,15-17H,6H2,(H,14,18)/t8?,9-,10?,11?/m0/s1 |
| InChIKey | DLVYKISZIHNFIN-ZQOALKFFSA-N |
| XLogP | -1.39 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |